পটাসিয়াম ডাইক্রোমেট: সংশোধিত সংস্করণের মধ্যে পার্থক্য
বিষয়বস্তু বিয়োগ হয়েছে বিষয়বস্তু যোগ হয়েছে
সংশোধন |
সম্পাদনা সারাংশ নেই |
||
১ নং লাইন:
{{chembox|verifiedrevid=406377229|Name=Potassium dichromate|ImageFile=Potassium-dichromate-sample.jpg|ImageName=Potassium dichromate|ImageFile1=Potassium-dichromate-unit-cell-3D-balls.png|ImageName1=Unit cell of potassium dichromate|IUPACName=Potassium dichromate(VI)|OtherNames=potassium bichromate<br>
{{কাজ চলছে/লক্ষ্য এবার লক্ষ}}'''পটাসিয়াম ডাইক্রোমেট''' ( রাসায়নিক সংকেত '''K<sub>2</sub>Cr<sub>2</sub>O<sub>7</sub>''' ) একটি অজৈব যৌগ। এটি একটি রাসায়নিক বিকারক। সাধারণতঃ এটি জারক পদার্থ হিসাবে বিভিন্ন পরীক্ষাগারে এবং শিল্পক্ষেত্রে ব্যবহার করা হয়।এই ষড়যোজী ক্রোমিয়াম যৌগটি আমাদের স্বাস্থ্যের পক্ষে ক্ষতিকর। এটি লাল-কমলা রঙের উজ্জ্বল কেলাস আকারে পাওয়া যায়। পরীক্ষাগারে এই লবণটি বেশ জনপ্রিয় কারণ এটি সোডিয়াম ডাইক্রোমেটের মতো জলাকর্ষী নয়।<ref name="Ullmann">Gerd Anger, Jost Halstenberg, Klaus Hochgeschwender, Christoph Scherhag, Ulrich Korallus, Herbert Knopf, Peter Schmidt, Manfred Ohlinger, "Chromium Compounds" in Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2005. {{DOI|10.1002/14356007.a07_067}}</ref>▼
bichromate of potash<br>
dipotassium dichromate<br>
dichromic acid, dipotassium salt<br>
chromic acid, dipotassium salt<br>
[[lopezite]]<ref>{{cite web|url=http://www.epa.gov/osw/hazard/wastetypes/wasteid/inorchem/docs/pot-dich.pdf|title=POTASSIUM DICHROMATE LISTING|publisher=US EPA|date=2015-07-23}}</ref>|Section1={{Chembox Identifiers
| CASNo = 7778-50-9
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = T4423S18FM
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22910
| ChEMBL = 1374101
| SMILES = [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI =1S/2Cr.2K.7O/q;;2*+1;;;;;;2*-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KMUONIBRACKNSN-UHFFFAOYSA-N
| PubChem = 24502
| EINECS = 231-906-6
| RTECS = HX7680000
| UNNumber = 3288
}}|Section2={{Chembox Properties
| Formula = K<sub>2</sub>Cr<sub>2</sub>O<sub>7</sub>
| MolarMass = 294.185 g/mol
| Appearance = red-orange crystalline solid
| Odor = odorless
| Density = 2.676 g/cm<sup>3</sup>, solid
| Solubility = 4.9 g/100 mL (0 °C) <br> 13 g/100 mL (20 °C) <br> 102 g/100 mL (100 °C)
| SolubleOther = insoluble in [[ethanol|alcohol]], [[acetone]].
| MeltingPtC = 398
| BoilingPtC = 500
| BoilingPt_notes = decomposes
| RefractIndex = 1.738
}}|Section3={{Chembox Structure
| Coordination = [[Tetrahedral]] (for Cr)
| CrystalStruct = [[Triclinic]] (α-form, <241.6 °C)
}}|Section4={{Chembox Thermochemistry
| DeltaHf = −2033 kJ/mol
| Entropy = 291.2 J/(K·mol)
| HeatCapacity = 219 J/mol<ref>{{cite book|pages=405|isbn=978-3-527-30524-7|date=2002|title=Thermochemical Data of Elements and Compounds|first1=M.|last1=Binnewies|first2=E.|last2=Milke|location=Weinheim|publisher=[[Wiley-VCH]]|edition=2}}</ref>
}}|Section7={{Chembox Hazards
| ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics1371.htm ICSC 1371]
| GHSPictograms = {{GHS03}}{{GHS05}}{{GHS06}}{{GHS08}}{{GHS09}}<ref name="sigma">{{Sigma-Aldrich|id=675644|name=Chromium(VI) oxide|accessdate=2014-06-15}}</ref>
| HPhrases =
| PPhrases =
| NFPA-H = 4
| NFPA-F = 0
| NFPA-R = 1
| NFPA-S = OX
| FlashPt = Non-flammable
| LD50 = 25 mg/kg (oral, rat)<ref>{{cite web|url=http://chem.sis.nlm.nih.gov/chemidplus/rn/7778-50-9|title=ChemIDplus - 7778-50-9 - KMUONIBRACKNSN-UHFFFAOYSA-N - Potassium dichromate - Similar structures search, synonyms, formulas, resource links, and other chemical information|first=Michael|last=Chambers|publisher=}}</ref>
}}|Section8={{Chembox Related
| OtherAnions = [[Potassium chromate]]<br />[[Potassium molybdate]]<br />[[Potassium tungstate]]
| OtherCations = [[Ammonium dichromate]]<br />[[Sodium dichromate]]
| OtherCompounds = [[Potassium permanganate]]
}}}}
▲
== রসায়ন ==
৩৯ ⟶ ৯৭ নং লাইন:
==== ইথানল নির্ধারণ ====
== সুরক্ষা ==
২০০৫-০৬ সালে অ্যালার্জি পরীক্ষায় (patch tests ) দেখা গিয়েছে অ্যালার্জি উৎপন্নকারি হিসাবে ১১তম স্থানে রয়েছে পটাসিয়াম ডাইক্রোমেট। শতকরা ৪.৮ ভাগ ক্ষেত্রে এই রাসায়নিকটি দায়ী।
৪৮ ⟶ ১০৪ নং লাইন:
== তথ্যসূত্র ==
{{reflist}}
| |||