"বিলিরুবিন" পাতাটির দুইটি সংশোধিত সংস্করণের মধ্যে পার্থক্য

সংশোধন
ট্যাগ: মোবাইল সম্পাদনা মোবাইল ওয়েব সম্পাদনা
(সংশোধন)
ট্যাগ: মোবাইল সম্পাদনা মোবাইল ওয়েব সম্পাদনা বাংলা নয় এমন বিষয়বস্তু অতি মাত্রায় যোগ
{{chembox
| Watchedfields = changed
| verifiedrevid = 443422624
| Name = বিলিরুবিন
| ImageFile = Bilirubin_ZZ.svg
| ImageSize =
| ImageFile1 = bilirubin-from-xtal-1978-3D-balls.png
| OtherNames =
| IUPACName =
| SystematicName =
| Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 4577
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4444055
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = RFM9X3LJ49
| InChIKey = BPYKTIZUTYGOLE-IFADSCNNBS
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 501680
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=635-65-4
| PubChem = 5280352
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16990
| SMILES = CC1=C(/C=C2C(C)=C(C=C)C(N/2)=O)NC(CC3=C(CCC(O)=O)C(C)=C(/C=C4C(C=C)=C(C)C(N/4)=O)N3)=C1CCC(O)=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C33H36N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-14,34-35H,1-2,9-12,15H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b26-13-,27-14-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BPYKTIZUTYGOLE-IFADSCNNSA-N
| SMILES1 = Cc1c(c([nH]c1/C=C\2/C(=C(C(=O)N2)C=C)C)Cc3c(c(c([nH]3)/C=C\4/C(=C(C(=O)N4)C)C=C)C)CCC(=O)O)CCC(=O)O
}}
 
[[চিত্র:Bilirubin.svg|320px|thumb|বিলিরুবিন]]
 
বেনামী ব্যবহারকারী