উইকিপিডিয়া

ফলিক অ্যাসিড: সংশোধিত সংস্করণের মধ্যে পার্থক্য

ইতিহাস ব্রাউজ করুন
পরবর্তী পার্থক্য →
বিষয়বস্তু বিয়োগ হয়েছে বিষয়বস্তু যোগ হয়েছে
দৃশ্যমানউইকিপাঠ্য
শুরু
 
ইনফোবক্স বাংলা, বিষয়শ্রেণী
১১ নং লাইন:
| ImageFile2 = Folic acid crystals.jpg
| ImageSize2 = 150px
| IUPACName = (২''এস'')-২-[(৪-{[(২-এমিনো-৪-হাইড্রোজিপ্টেরিডিন-৬-yl),মিথাইল]এমিনো}ফেনিল)ফর্মামিডো]পেন্টানিডিওইক এসিড
| IUPACName = (2''S'')-2-[(4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid
| OtherNames = ''N''-&#x200b;(4-&#x200b;{[(2-&#x200b;amino-&#x200b;4-&#x200b;oxo-&#x200b;1,&#x200b;4-&#x200b;dihydropteridin-&#x200b;6-&#x200b;yl)&#x200b;methyl]&#x200b;amino}&#x200b;benzoyl)-&#x200b;<small>L</small>-&#x200b;glutamicগ্লুটামিক acidএসিড; pteroylটেরইল-Lএল-glutamicগ্লুটামিক acidএসিড; Vitaminভিটামিন B<sub>9</sub>বি নাইন; Vitaminভিটামিন B<sub>cবি</sub>সি; Folacinফোলাসিন
| Section1 = {{Chembox Identifiers
|PubChem=6037৬০৩৭
 
| SMILES = c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCc2cnc3c(n2)c(=O)nc([nH]3)N
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5815৫৮১৫
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 935E97BOY8
২৯ নং লাইন:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OVBPIULPVIDEAO-LBPRGKRZSA-N
| CASNo = 59৫৯-30৩০-3৩
| CASNo_Ref = {{cascite|correct|CAS}}
}}
| Section2 = {{Chembox Properties
| C=19 | H=19 | N=7 | O=6
| Appearance = হলুদ-কমলা স্ফটিক এর পাউডার বা গুঁড়ো
| Appearance = yellow-orange crystalline powder
| Density =
| Solubility = 1১.6৬ mgমিগ্রা/Lলি (25২৫ °C)<ref name=chemid>{{ChemID|59-30-3}}</ref>
| MeltingPt = 250২৫০ °C (523৫২৩ Kকেলভিন), [[Chemical decomposition|decomp.]]<ref name=chemid/>
| pKa = 1<sup>st</sup>১ম: 4৪.65৬৫, 2<sup>nd</sup>২য়: 6৬.75৭৫, 3<sup>rd</sup>৩য়: 9৯.00০০<ref>R. M. C. Dawson: ''Data for Biochemical Research'', Oxford University Press, Oxford, 1989, 3<sub>rd</sub> Edition, p.&nbsp;134, ISBN 0-19-855299-8.</ref>
}}
| Section7 = {{Chembox Hazards
৪৫ নং লাইন:
}}
 
'''ফলিক এসিড''' বা '''ভিটামিন বি নাইন'''<ref>{{cite web | last = Ural | first = Serdar H. | title = Folic Acid and Pregnancy. | publisher = Kid's Health | date = 2008-11 | url = http://kidshealth.org/parent/pregnancy_newborn/pregnancy/folic_acid.html }}</ref> বা '''ভিটামিন বি<sub>সি'''<ref>http://medical-dictionary.thefreedictionary.com/vitamin+Bc</ref>, অথবা '''ফোলেট''' নামে মানবদেহে প্রাকৃতিকভাবে সৃষ্ট এর রূপভেদ (যা '''টেরইল-এল-গ্লুটামিক এসিড''', '''টেরইল এল-গ্লুটামেট''' এবং '''টেরইলমনোগ্লুটামিক এসিড''' <ref name="mayofolate">[Mayo Clinic Web Editors . Folate. http://www.mayoclinic.com/health/folate/NS_patient-folate/DSECTION=synonyms (accessed Nov 15, 2010).],additional text.</ref> নামেও পরিচিত) হলো পানিতে দ্রবণীয় ভিটামিন বি নাইন এর রূপ। ফলিক এসিড নিজে জৈবিকভাবে বিক্রিয়াশীল না হলেও মানবদেহের [[যকৃত|যকৃতে]] ডাইহাইড্রোফলিক এসিড হতে এর রূপান্তরের পরে টেট্রাহাইড্রোফোলেট এবং অন্যান্য উপজাতের কারণে এটি অতীব গুরুত্বপূর্ণ। গুরুত্বপূর্ণ<ref name="Bailey">{{cite journal |author=Bailey SW, Ayling JE |title=The extremely slow and variable activity of dihydrofolate reductase in human liver and its implications for high folic acid intake |journal=Proceedings of the National Academy of Sciences of the United States of America |volume=106 |issue=36 |pages=15424–9 |year=2009 |month=September |pmid=19706381 |pmc=2730961 |doi=10.1073/pnas.0902072106}}</ref>।
 
 
ফলিক এসিড দেহের অনেক গুরুত্বপূর্ণ কার্যসম্পাদনে সহায়ক ভূমিকা রাখে। এটি [[ডিএনএ]] গঠন বা সিন্থেসাইজেশন, কোষ বিভাজন এবং ডিএনএ মেরামত করতে সাহায্য করে<ref name="ReferenceA">{{cite journal | last1 = Weinstein | first1 = SJ ''et al.'' | year = 2003 | title = Null Association Between Prostate Cancer and Serum Folate, Vitamin B6, Vitamin B12, and Homocysteine | url =http://cebp.aacrjournals.org/content/12/11/1271.full.pdf |format=PDF |accessdate=1 December 2010 | journal = Cancer Epidemiology, Biomarkers, & Prevention | volume = 12 | issue = 11| pages = 1271–1272 }}</ref>।
৫১ ⟶ ৫২ নং লাইন:
==তথ্যসূত্র==
<references/>
 
[[বিষয়শ্রেণী:পুষ্টি]]
 
[[en:Folic acid]]
'https://bn.wikipedia.org/wiki/ফলিক_অ্যাসিড' থেকে আনীত